CAS 110269-50-6 is the registry number for Machilin A. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg.
5-[(2R,3S)-4-(1,3-benzodioxol-5-yl)-2,3-dimethylbutyl]-1,3-benzodioxole (CAS 110269-50-6) is a chemical compound with the molecular formula C20H22O4 and a molecular weight of 326.4 g/mol. IUPAC name: 5-[(2R,3S)-4-(1,3-benzodioxol-5-yl)-2,3-dimethylbutyl]-1,3-benzodioxole. InChIKey: QEFJURUMSHPMTC-OKILXGFUSA-N.
| Molecular formula | C20H22O4 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 5-[(2R,3S)-4-(1,3-benzodioxol-5-yl)-2,3-dimethylbutyl]-1,3-benzodioxole |
| InChIKey | QEFJURUMSHPMTC-OKILXGFUSA-N |
| SMILES | C[C@H](CC1=CC2=C(C=C1)OCO2)[C@@H](C)CC3=CC4=C(C=C3)OCO4 |
Computed by PubChem (NCBI)