CAS 110300-04-4 is the registry number for 2-Amino-3-(2,3-dichlorophenyl)propanoic acid, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
2-amino-3-(2,3-dichlorophenyl)propanoic acid (CAS 110300-04-4) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: 2-amino-3-(2,3-dichlorophenyl)propanoic acid. InChIKey: NVDAAIHKUHFKOL-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | 2-amino-3-(2,3-dichlorophenyl)propanoic acid |
| InChIKey | NVDAAIHKUHFKOL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)CC(C(=O)O)N |
Computed by PubChem (NCBI)