CAS 1241677-43-9 appears in our catalog under these names: 2,3-Dichloro-d-phenylalanine, 95%, (R)-2-Amino-3-(2,3-dichlorophenyl)propanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
(2R)-2-amino-3-(2,3-dichlorophenyl)propanoic acid (CAS 1241677-43-9) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: (2R)-2-amino-3-(2,3-dichlorophenyl)propanoic acid. InChIKey: NVDAAIHKUHFKOL-SSDOTTSWSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | (2R)-2-amino-3-(2,3-dichlorophenyl)propanoic acid |
| InChIKey | NVDAAIHKUHFKOL-SSDOTTSWSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)