Products 1103837-39-3
CAS 1103837-39-3 appears in our catalog under these names: Methyl 5-chloro-2-hydroxy-4-(trifluoromethyl)benzoate, 95%, Methyl 5–chloro–2–hydroxy–4–(trifluoromethyl)benzoate. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, BLDpharm. Available pack sizes: 1g, 5g, 100mg, 250mg.
Methyl 5-chloro-2-hydroxy-4-(trifluoromethyl)benzoate (CAS 1103837-39-3) is a chemical compound with the molecular formula C9H6ClF3O3 and a molecular weight of 254.59 g/mol. IUPAC name: methyl 5-chloro-2-hydroxy-4-(trifluoromethyl)benzoate. InChIKey: KBMVLEGUYRDYPH-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3O3 |
|---|---|
| Molecular weight | 254.59 g/mol |
| IUPAC name | methyl 5-chloro-2-hydroxy-4-(trifluoromethyl)benzoate |
| InChIKey | KBMVLEGUYRDYPH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)