Products 1104505-81-8
CAS 1104505-81-8 appears in our catalog under these names: 3-Aminobenzo[d]isoxazole-4-carboxylic acid, 95%, 3-Aminobenzo(d)isoxazole-4-carboxylic Acid, 3-Aminobenzo[d]isoxazole-4-carboxylic Acid, ≥95%, ≥95%, 3-AMINOBENZO[D]ISOXAZOLE-4-CARBOXYLIC ACID, ≥95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 0,5g, 50mg.
3-amino-1,2-benzoxazole-4-carboxylic acid (CAS 1104505-81-8) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 3-amino-1,2-benzoxazole-4-carboxylic acid. InChIKey: FCIMKUURFDDBAB-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 3-amino-1,2-benzoxazole-4-carboxylic acid |
| InChIKey | FCIMKUURFDDBAB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)ON=C2N)C(=O)O |
Computed by PubChem (NCBI)