Products 1105044-28-7
CAS 1105044-28-7 is the registry number for 3-((3-Chloro-4-methoxyphenyl)amino)-1-methylpyrrolidine-2,5-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3-chloro-4-methoxyanilino)-1-methylpyrrolidine-2,5-dione (CAS 1105044-28-7) is a chemical compound with the molecular formula C12H13ClN2O3 and a molecular weight of 268.69 g/mol. IUPAC name: 3-(3-chloro-4-methoxyanilino)-1-methylpyrrolidine-2,5-dione. InChIKey: PHSQQZCTFCDPJB-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2O3 |
|---|---|
| Molecular weight | 268.69 g/mol |
| IUPAC name | 3-(3-chloro-4-methoxyanilino)-1-methylpyrrolidine-2,5-dione |
| InChIKey | PHSQQZCTFCDPJB-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CC(C1=O)NC2=CC(=C(C=C2)OC)Cl |
Computed by PubChem (NCBI)