CAS 367453-01-8 appears in our catalog under these names: (2R)-2-amino-3-(1-formylindol-3-yl)propanoic acid hydrochloride, 98%, H-D-Trp(For)-OH*HCl. Offered by: Combi-blocks, Iris Biotech. Available pack sizes: 5g, 25g, 1g.
(2R)-2-amino-3-(1-formylindol-3-yl)propanoic acid;hydrochloride (CAS 367453-01-8) is a chemical compound with the molecular formula C12H13ClN2O3 and a molecular weight of 268.69 g/mol. IUPAC name: (2R)-2-amino-3-(1-formylindol-3-yl)propanoic acid;hydrochloride. InChIKey: GWYUYJDIFZXFJT-HNCPQSOCSA-N.
| Molecular formula | C12H13ClN2O3 |
|---|---|
| Molecular weight | 268.69 g/mol |
| IUPAC name | (2R)-2-amino-3-(1-formylindol-3-yl)propanoic acid;hydrochloride |
| InChIKey | GWYUYJDIFZXFJT-HNCPQSOCSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2C=O)C[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)