CAS 38023-86-8 appears in our catalog under these names: (2S)-2-amino-3-(1-formylindol-3-yl)propanoic acid hydrochloride, 98%, (S)-2-Amino-3-(1-formyl-1H-indol-3-yl)propanoic acid hydrochloride, 95+%, H-L-Trp(For)-OH*HCl, Nin-Formyl-L-tryptophan hydrochloride, 99%. Offered by: Combi-blocks, AmBeed, Iris Biotech, Fluorochem. Available pack sizes: 25g, 100g, 5g, 1g.
(2S)-2-amino-3-(1-formylindol-3-yl)propanoic acid;hydrochloride (CAS 38023-86-8) is a chemical compound with the molecular formula C12H13ClN2O3 and a molecular weight of 268.69 g/mol. IUPAC name: (2S)-2-amino-3-(1-formylindol-3-yl)propanoic acid;hydrochloride. InChIKey: GWYUYJDIFZXFJT-PPHPATTJSA-N.
| Molecular formula | C12H13ClN2O3 |
|---|---|
| Molecular weight | 268.69 g/mol |
| IUPAC name | (2S)-2-amino-3-(1-formylindol-3-yl)propanoic acid;hydrochloride |
| InChIKey | GWYUYJDIFZXFJT-PPHPATTJSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2C=O)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)