Products 339059-83-5
CAS 339059-83-5 appears in our catalog under these names: 4-Chloro-n-cyclopentyl-3-nitrobenzamide, 95%, 4-Chloro-N-cyclopentyl-3-nitrobenzamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
4-chloro-N-cyclopentyl-3-nitrobenzamide (CAS 339059-83-5) is a chemical compound with the molecular formula C12H13ClN2O3 and a molecular weight of 268.69 g/mol. IUPAC name: 4-chloro-N-cyclopentyl-3-nitrobenzamide. InChIKey: VZZDMSAFALTDME-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2O3 |
|---|---|
| Molecular weight | 268.69 g/mol |
| IUPAC name | 4-chloro-N-cyclopentyl-3-nitrobenzamide |
| InChIKey | VZZDMSAFALTDME-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NC(=O)C2=CC(=C(C=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)