CAS 4876-14-6 appears in our catalog under these names: Rebamipide Impurity 3 HCl, N-des(4-Chlorobenzoyl) Rebamipide, >95% (HPLC), 2–Amino–3–(2–oxo–1,2–dihydroquinolin–4–yl)propanoic acid hydrochloride, 3-(2-Oxo-1,2-dihydro-4-quinolinyl)-DL-alanine Hydrochloride, >98.0%(HPLC)(N), H-DL-Ala(2-oxo-1,2-dihydroquinolin-4-yl)-OH HCl 98% +(contains 10-15%H2O). Offered by: Chemat Brand, TRC, GLPBio, TCI, Ambeed. Available pack sizes: on request, 1g, 5g, 25g, 100g, 500g, 10g, 100 g.
2-amino-3-(2-oxo-1H-quinolin-4-yl)propanoic acid;hydrochloride (CAS 4876-14-6) is a chemical compound with the molecular formula C12H13ClN2O3 and a molecular weight of 268.69 g/mol. IUPAC name: 2-amino-3-(2-oxo-1H-quinolin-4-yl)propanoic acid;hydrochloride. InChIKey: MPTXVJCCTVAVNL-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2O3 |
|---|---|
| Molecular weight | 268.69 g/mol |
| IUPAC name | 2-amino-3-(2-oxo-1H-quinolin-4-yl)propanoic acid;hydrochloride |
| InChIKey | MPTXVJCCTVAVNL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=O)N2)CC(C(=O)O)N.Cl |
Computed by PubChem (NCBI)