CAS 744258-91-1 is the registry number for 2-(Cyclopropylamino)-2-oxoethyl 3-amino-4-chlorobenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[2-(cyclopropylamino)-2-oxoethyl] 3-amino-4-chlorobenzoate (CAS 744258-91-1) is a chemical compound with the molecular formula C12H13ClN2O3 and a molecular weight of 268.69 g/mol. IUPAC name: [2-(cyclopropylamino)-2-oxoethyl] 3-amino-4-chlorobenzoate. InChIKey: NCHJGMMEDVLWSR-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2O3 |
|---|---|
| Molecular weight | 268.69 g/mol |
| IUPAC name | [2-(cyclopropylamino)-2-oxoethyl] 3-amino-4-chlorobenzoate |
| InChIKey | NCHJGMMEDVLWSR-UHFFFAOYSA-N |
| SMILES | C1CC1NC(=O)COC(=O)C2=CC(=C(C=C2)Cl)N |
Computed by PubChem (NCBI)