CAS 1105194-30-6 appears in our catalog under these names: 6-(Naphthalen-1-yl)-2,3-dihydropyridazin-3-one, 95%, 6-(NAphthalen-1-yl)-2,3-dihydropyridazin-3-one, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-naphthalen-1-yl-1H-pyridazin-6-one (CAS 1105194-30-6) is a chemical compound with the molecular formula C14H10N2O and a molecular weight of 222.24 g/mol. IUPAC name: 3-naphthalen-1-yl-1H-pyridazin-6-one. InChIKey: ICAGUJCIYINNRR-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 3-naphthalen-1-yl-1H-pyridazin-6-one |
| InChIKey | ICAGUJCIYINNRR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C3=NNC(=O)C=C3 |
Computed by PubChem (NCBI)