CAS 110568-64-4 appears in our catalog under these names: 6-Nitroisoindolin-1-one 96%, 6-Nitroisoindolin-1-one, 96%, 96%, 6-Nitroisoindolin-1-one, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
6-nitro-2,3-dihydroisoindol-1-one (CAS 110568-64-4) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 6-nitro-2,3-dihydroisoindol-1-one. InChIKey: QKFIHDGZIPOWKP-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 6-nitro-2,3-dihydroisoindol-1-one |
| InChIKey | QKFIHDGZIPOWKP-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)[N+](=O)[O-])C(=O)N1 |
Computed by PubChem (NCBI)