Products 1106692-23-2
CAS 1106692-23-2 appears in our catalog under these names: 5-(Dimethylamino)-2-methylphenylboronic acid, 95%, (5-(Dimethylamino)-2-methylphenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 10g, 5g, 1g.
[5-(dimethylamino)-2-methylphenyl]boronic acid (CAS 1106692-23-2) is a chemical compound with the molecular formula C9H14BNO2 and a molecular weight of 179.03 g/mol. IUPAC name: [5-(dimethylamino)-2-methylphenyl]boronic acid. InChIKey: AJBBUAFACTUWSI-UHFFFAOYSA-N.
| Molecular formula | C9H14BNO2 |
|---|---|
| Molecular weight | 179.03 g/mol |
| IUPAC name | [5-(dimethylamino)-2-methylphenyl]boronic acid |
| InChIKey | AJBBUAFACTUWSI-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)N(C)C)C)(O)O |
Computed by PubChem (NCBI)