CAS 2241876-05-9 is the registry number for (5–(methyl–d3)–6–(propyl–d7)pyridin–3–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[6-(1,1,2,2,3,3,3-heptadeuteriopropyl)-5-(trideuteriomethyl)-3-pyridinyl]boronic acid (CAS 2241876-05-9) is a chemical compound with the molecular formula C9H14BNO2 and a molecular weight of 189.09 g/mol. IUPAC name: [6-(1,1,2,2,3,3,3-heptadeuteriopropyl)-5-(trideuteriomethyl)-3-pyridinyl]boronic acid. InChIKey: VQXNPOPZEGGVCW-MWUKXHIBSA-N.
| Molecular formula | C9H14BNO2 |
|---|---|
| Molecular weight | 189.09 g/mol |
| IUPAC name | [6-(1,1,2,2,3,3,3-heptadeuteriopropyl)-5-(trideuteriomethyl)-3-pyridinyl]boronic acid |
| InChIKey | VQXNPOPZEGGVCW-MWUKXHIBSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(N=CC(=C1)B(O)O)C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)