Products 919496-59-6
CAS 919496-59-6 appears in our catalog under these names: N,N,2-Trimethylaniline-4-boronic acid, 95%, (4-(Dimethylamino)-3-methylphenyl)boronic acid, 95+%, N,N,2-Trimethylaniline-4-boronic acid, (4-(Dimethylamino)-3-methylphenyl)boronic acid 93%, N,N,2-Trimethylaniline-4-boronic acid, 93%, 93%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 25g, 5g, 10g, 250mg.
[4-(dimethylamino)-3-methylphenyl]boronic acid (CAS 919496-59-6) is a chemical compound with the molecular formula C9H14BNO2 and a molecular weight of 179.03 g/mol. IUPAC name: [4-(dimethylamino)-3-methylphenyl]boronic acid. InChIKey: HCWIPDGKOJNTJY-UHFFFAOYSA-N.
| Molecular formula | C9H14BNO2 |
|---|---|
| Molecular weight | 179.03 g/mol |
| IUPAC name | [4-(dimethylamino)-3-methylphenyl]boronic acid |
| InChIKey | HCWIPDGKOJNTJY-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)N(C)C)C)(O)O |
Computed by PubChem (NCBI)