CAS 819849-22-4 appears in our catalog under these names: 3-(N, N-Dimethylaminomethyl) phenylboronic acid, 96%, 3-((Dimethylamino)methyl)phenylboronic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 10g, 5g.
[3-[(dimethylamino)methyl]phenyl]boronic acid (CAS 819849-22-4) is a chemical compound with the molecular formula C9H14BNO2 and a molecular weight of 179.03 g/mol. IUPAC name: [3-[(dimethylamino)methyl]phenyl]boronic acid. InChIKey: OFYQEYPITRRCBP-UHFFFAOYSA-N.
| Molecular formula | C9H14BNO2 |
|---|---|
| Molecular weight | 179.03 g/mol |
| IUPAC name | [3-[(dimethylamino)methyl]phenyl]boronic acid |
| InChIKey | OFYQEYPITRRCBP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)CN(C)C)(O)O |
Computed by PubChem (NCBI)