CAS 2000187-68-6 is the registry number for (2–(tert–butyl)pyridin–4–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
(2-tert-butyl-4-pyridinyl)boronic acid (CAS 2000187-68-6) is a chemical compound with the molecular formula C9H14BNO2 and a molecular weight of 179.03 g/mol. IUPAC name: (2-tert-butyl-4-pyridinyl)boronic acid. InChIKey: AUKMAUQROCBPLU-UHFFFAOYSA-N.
| Molecular formula | C9H14BNO2 |
|---|---|
| Molecular weight | 179.03 g/mol |
| IUPAC name | (2-tert-butyl-4-pyridinyl)boronic acid |
| InChIKey | AUKMAUQROCBPLU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC=C1)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)