CAS 70799-12-1 appears in our catalog under these names: 4–((Dimethylamino)methyl)phenylboronic acid, 4-((Dimethylamino)methyl)phenylboronic acid 97%, 4-((Dimethylamino)methyl)phenylboronic acid, 97%, 97%, 4-((Dimethylamino)methyl)phenylboronic acid, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g.
[4-[(dimethylamino)methyl]phenyl]boronic acid (CAS 70799-12-1) is a chemical compound with the molecular formula C9H14BNO2 and a molecular weight of 179.03 g/mol. IUPAC name: [4-[(dimethylamino)methyl]phenyl]boronic acid. InChIKey: LRWRYAVXFZBFRJ-UHFFFAOYSA-N.
| Molecular formula | C9H14BNO2 |
|---|---|
| Molecular weight | 179.03 g/mol |
| IUPAC name | [4-[(dimethylamino)methyl]phenyl]boronic acid |
| InChIKey | LRWRYAVXFZBFRJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CN(C)C)(O)O |
Computed by PubChem (NCBI)