CAS 1107627-20-2 appears in our catalog under these names: Benzo[d]thiazol-5-ylboronic acid, 98%, 98%, Benzo[d]thiazol-5-ylboronic acid, 98%, Benzo[d]thiazol-5-ylboronic acid, 98+%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g.
1,3-benzothiazol-5-ylboronic acid (CAS 1107627-20-2) is a chemical compound with the molecular formula C7H6BNO2S and a molecular weight of 179.01 g/mol. IUPAC name: 1,3-benzothiazol-5-ylboronic acid. InChIKey: WAHQRIKMSIJALP-UHFFFAOYSA-N.
| Molecular formula | C7H6BNO2S |
|---|---|
| Molecular weight | 179.01 g/mol |
| IUPAC name | 1,3-benzothiazol-5-ylboronic acid |
| InChIKey | WAHQRIKMSIJALP-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)SC=N2)(O)O |
Computed by PubChem (NCBI)