Products 1492031-92-1
CAS 1492031-92-1 is the registry number for Thieno[3,2-b]pyridin-7-ylboronic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Thieno[3,2-b]pyridin-7-ylboronic acid (CAS 1492031-92-1) is a chemical compound with the molecular formula C7H6BNO2S and a molecular weight of 179.01 g/mol. IUPAC name: thieno[3,2-b]pyridin-7-ylboronic acid. InChIKey: ZCRLQDWVRFMLJW-UHFFFAOYSA-N.
| Molecular formula | C7H6BNO2S |
|---|---|
| Molecular weight | 179.01 g/mol |
| IUPAC name | thieno[3,2-b]pyridin-7-ylboronic acid |
| InChIKey | ZCRLQDWVRFMLJW-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=NC=C1)C=CS2)(O)O |
Computed by PubChem (NCBI)