Products 1310404-02-4

CAS 1310404-02-4 is the registry number for Benzo[c]isothiazol-5-ylboronic acid, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.

2,1-benzothiazol-5-ylboronic acid (CAS 1310404-02-4) is a chemical compound with the molecular formula C7H6BNO2S and a molecular weight of 179.01 g/mol. IUPAC name: 2,1-benzothiazol-5-ylboronic acid. InChIKey: HQNQYXUHTJKKPM-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6BNO2S
Molecular weight179.01 g/mol
IUPAC name2,1-benzothiazol-5-ylboronic acid
InChIKeyHQNQYXUHTJKKPM-UHFFFAOYSA-N
SMILESB(C1=CC2=CSN=C2C=C1)(O)O

Computed by PubChem (NCBI)