Products 1352796-62-3

CAS 1352796-62-3 is the registry number for Benzo[d]thiazol-4-ylboronic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

1,3-benzothiazol-4-ylboronic acid (CAS 1352796-62-3) is a chemical compound with the molecular formula C7H6BNO2S and a molecular weight of 179.01 g/mol. IUPAC name: 1,3-benzothiazol-4-ylboronic acid. InChIKey: SHSQZIGLISBBRG-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6BNO2S
Molecular weight179.01 g/mol
IUPAC name1,3-benzothiazol-4-ylboronic acid
InChIKeySHSQZIGLISBBRG-UHFFFAOYSA-N
SMILESB(C1=C2C(=CC=C1)SC=N2)(O)O

Computed by PubChem (NCBI)