CAS 1352796-62-3 is the registry number for Benzo[d]thiazol-4-ylboronic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-benzothiazol-4-ylboronic acid (CAS 1352796-62-3) is a chemical compound with the molecular formula C7H6BNO2S and a molecular weight of 179.01 g/mol. IUPAC name: 1,3-benzothiazol-4-ylboronic acid. InChIKey: SHSQZIGLISBBRG-UHFFFAOYSA-N.
| Molecular formula | C7H6BNO2S |
|---|---|
| Molecular weight | 179.01 g/mol |
| IUPAC name | 1,3-benzothiazol-4-ylboronic acid |
| InChIKey | SHSQZIGLISBBRG-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=CC=C1)SC=N2)(O)O |
Computed by PubChem (NCBI)