Products 1909346-58-2

CAS 1909346-58-2 is the registry number for Thieno[2,3-c]pyridin-3-ylboronic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Thieno[2,3-c]pyridin-3-ylboronic acid (CAS 1909346-58-2) is a chemical compound with the molecular formula C7H6BNO2S and a molecular weight of 179.01 g/mol. IUPAC name: thieno[2,3-c]pyridin-3-ylboronic acid. InChIKey: TXPQUTFBGIVFCG-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6BNO2S
Molecular weight179.01 g/mol
IUPAC namethieno[2,3-c]pyridin-3-ylboronic acid
InChIKeyTXPQUTFBGIVFCG-UHFFFAOYSA-N
SMILESB(C1=CSC2=C1C=CN=C2)(O)O

Computed by PubChem (NCBI)