CAS 953411-01-3 is the registry number for {Thieno(2,3-b)pyridin-2-yl}boronic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Thieno[2,3-b]pyridin-2-ylboronic acid (CAS 953411-01-3) is a chemical compound with the molecular formula C7H6BNO2S and a molecular weight of 179.01 g/mol. IUPAC name: thieno[2,3-b]pyridin-2-ylboronic acid. InChIKey: MNEBNNDPFRPIIT-UHFFFAOYSA-N.
| Molecular formula | C7H6BNO2S |
|---|---|
| Molecular weight | 179.01 g/mol |
| IUPAC name | thieno[2,3-b]pyridin-2-ylboronic acid |
| InChIKey | MNEBNNDPFRPIIT-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(S1)N=CC=C2)(O)O |
Computed by PubChem (NCBI)