CAS 110888-22-7 is the registry number for 4-Sulfanyl-2-(trifluoromethyl)benzonitrile. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-sulfanyl-2-(trifluoromethyl)benzonitrile (CAS 110888-22-7) is a chemical compound with the molecular formula C8H4F3NS and a molecular weight of 203.19 g/mol. IUPAC name: 4-sulfanyl-2-(trifluoromethyl)benzonitrile. InChIKey: IWZHVFBVXGOFHM-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NS |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 4-sulfanyl-2-(trifluoromethyl)benzonitrile |
| InChIKey | IWZHVFBVXGOFHM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S)C(F)(F)F)C#N |
Computed by PubChem (NCBI)