CAS 131337-62-7 appears in our catalog under these names: 5-(TRIFLUOROMETHYL)-1,3-BENZOTHIAZOLE, 98%, 98%, 5-(Trifluoromethyl)benzo[d]thiazole, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg.
5-(trifluoromethyl)-1,3-benzothiazole (CAS 131337-62-7) is a chemical compound with the molecular formula C8H4F3NS and a molecular weight of 203.19 g/mol. IUPAC name: 5-(trifluoromethyl)-1,3-benzothiazole. InChIKey: ODSGKKPRKQLYDA-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NS |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 5-(trifluoromethyl)-1,3-benzothiazole |
| InChIKey | ODSGKKPRKQLYDA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)N=CS2 |
Computed by PubChem (NCBI)