CAS 537033-60-6 is the registry number for 5-(Trifluoromethyl)thieno(3,2-b)pyridine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(trifluoromethyl)thieno[3,2-b]pyridine (CAS 537033-60-6) is a chemical compound with the molecular formula C8H4F3NS and a molecular weight of 203.19 g/mol. IUPAC name: 5-(trifluoromethyl)thieno[3,2-b]pyridine. InChIKey: VHIPXYTUUONNMD-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NS |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 5-(trifluoromethyl)thieno[3,2-b]pyridine |
| InChIKey | VHIPXYTUUONNMD-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1SC=C2)C(F)(F)F |
Computed by PubChem (NCBI)