CAS 110932-42-8 is the registry number for 5-(Biphenyl-4-yl methylidene)imidazolidine-2,4-dione. Offered by: TRC. Available pack sizes: 1g.
5-[(4-phenylphenyl)methylidene]imidazolidine-2,4-dione (CAS 110932-42-8) is a chemical compound with the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. IUPAC name: 5-[(4-phenylphenyl)methylidene]imidazolidine-2,4-dione. InChIKey: QIYDZMXXQWNWHJ-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O2 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | 5-[(4-phenylphenyl)methylidene]imidazolidine-2,4-dione |
| InChIKey | QIYDZMXXQWNWHJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C=C3C(=O)NC(=O)N3 |
Computed by PubChem (NCBI)