CAS 111119-37-0 appears in our catalog under these names: (S)–2–Amino–3–(2,6–dichlorophenyl)propanoic acid, H-L-Phe(2,6-Cl2)-OH. Offered by: GLPBio, Iris Biotech. Available pack sizes: 1g, 10mg.
(2S)-2-amino-3-(2,6-dichlorophenyl)propanoic acid (CAS 111119-37-0) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: (2S)-2-amino-3-(2,6-dichlorophenyl)propanoic acid. InChIKey: LWFYNRYRKMEIIJ-QMMMGPOBSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | (2S)-2-amino-3-(2,6-dichlorophenyl)propanoic acid |
| InChIKey | LWFYNRYRKMEIIJ-QMMMGPOBSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C[C@@H](C(=O)O)N)Cl |
Computed by PubChem (NCBI)