CAS 111185-87-6 appears in our catalog under these names: 4-Oxo-1H-quinoline-3,8-dicarboxylic acid, 98%, 4-Oxo-1,4-dihydroquinoline-3,8-dicarboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4-oxo-1H-quinoline-3,8-dicarboxylic acid (CAS 111185-87-6) is a chemical compound with the molecular formula C11H7NO5 and a molecular weight of 233.18 g/mol. IUPAC name: 4-oxo-1H-quinoline-3,8-dicarboxylic acid. InChIKey: YYLVBIBWUBXXRA-UHFFFAOYSA-N.
| Molecular formula | C11H7NO5 |
|---|---|
| Molecular weight | 233.18 g/mol |
| IUPAC name | 4-oxo-1H-quinoline-3,8-dicarboxylic acid |
| InChIKey | YYLVBIBWUBXXRA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C(=O)O)NC=C(C2=O)C(=O)O |
Computed by PubChem (NCBI)