Products 885273-88-1

CAS 885273-88-1 is the registry number for 2-Benzo[1,3]dioxol-5-yl-oxazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxylic acid (CAS 885273-88-1) is a chemical compound with the molecular formula C11H7NO5 and a molecular weight of 233.18 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxylic acid. InChIKey: UACXQAZNLXMPKB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7NO5
Molecular weight233.18 g/mol
IUPAC name2-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxylic acid
InChIKeyUACXQAZNLXMPKB-UHFFFAOYSA-N
SMILESC1OC2=C(O1)C=C(C=C2)C3=NC(=CO3)C(=O)O

Computed by PubChem (NCBI)