CAS 885273-88-1 is the registry number for 2-Benzo[1,3]dioxol-5-yl-oxazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxylic acid (CAS 885273-88-1) is a chemical compound with the molecular formula C11H7NO5 and a molecular weight of 233.18 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxylic acid. InChIKey: UACXQAZNLXMPKB-UHFFFAOYSA-N.
| Molecular formula | C11H7NO5 |
|---|---|
| Molecular weight | 233.18 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxylic acid |
| InChIKey | UACXQAZNLXMPKB-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C3=NC(=CO3)C(=O)O |
Computed by PubChem (NCBI)