CAS 15926-44-0 appears in our catalog under these names: 2-Phenyl-1,3-oxazole-4,5-dicarboxylic acid, 95%, 2-Phenyl-1,3-oxazole-4,5-dicarboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-phenyl-1,3-oxazole-4,5-dicarboxylic acid (CAS 15926-44-0) is a chemical compound with the molecular formula C11H7NO5 and a molecular weight of 233.18 g/mol. IUPAC name: 2-phenyl-1,3-oxazole-4,5-dicarboxylic acid. InChIKey: YRGAADYUKSMBJS-UHFFFAOYSA-N.
| Molecular formula | C11H7NO5 |
|---|---|
| Molecular weight | 233.18 g/mol |
| IUPAC name | 2-phenyl-1,3-oxazole-4,5-dicarboxylic acid |
| InChIKey | YRGAADYUKSMBJS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=C(O2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)