CAS 1375064-71-3 appears in our catalog under these names: 5–(4–Carboxyphenyl)isoxazole–3–carboxylic Acid, 5-(4-CARBOXYPHENYL)ISOXAZOLE-3-CARBOXYLIC ACID, 5-(4-Carboxyphenyl)isoxazole-3-carboxylic acid, 95%, 5-(4-Carboxyphenyl)isoxazole-3-carboxylic Acid, >95%, >95%. Offered by: GLPBio, Fluorochem, Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg.
5-(4-carboxyphenyl)-1,2-oxazole-3-carboxylic acid (CAS 1375064-71-3) is a chemical compound with the molecular formula C11H7NO5 and a molecular weight of 233.18 g/mol. IUPAC name: 5-(4-carboxyphenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: FUWUAFDSPMHYPU-UHFFFAOYSA-N.
| Molecular formula | C11H7NO5 |
|---|---|
| Molecular weight | 233.18 g/mol |
| IUPAC name | 5-(4-carboxyphenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | FUWUAFDSPMHYPU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NO2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)