CAS 19232-43-0 appears in our catalog under these names: 4-Maleimidosalicylic acid, 95+%, 4-Maleimidosalicylic acid. Offered by: AmBeed, MedChemExpress. Available pack sizes: 25mg, Get quote.
4-(2,5-dioxopyrrol-1-yl)-2-hydroxybenzoic acid (CAS 19232-43-0) is a chemical compound with the molecular formula C11H7NO5 and a molecular weight of 233.18 g/mol. IUPAC name: 4-(2,5-dioxopyrrol-1-yl)-2-hydroxybenzoic acid. InChIKey: SMSVFCGGVBWUJL-UHFFFAOYSA-N.
| Molecular formula | C11H7NO5 |
|---|---|
| Molecular weight | 233.18 g/mol |
| IUPAC name | 4-(2,5-dioxopyrrol-1-yl)-2-hydroxybenzoic acid |
| InChIKey | SMSVFCGGVBWUJL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N2C(=O)C=CC2=O)O)C(=O)O |
Computed by PubChem (NCBI)