CAS 668971-47-9 appears in our catalog under these names: 5-(1,3-Benzodioxol-5-yl)isoxazole-3-carboxylic acid, 95%, 5-(Benzo(d)(1,3)dioxol-5-yl)isoxazole-3-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 25g, 1g.
5-(1,3-benzodioxol-5-yl)-1,2-oxazole-3-carboxylic acid (CAS 668971-47-9) is a chemical compound with the molecular formula C11H7NO5 and a molecular weight of 233.18 g/mol. IUPAC name: 5-(1,3-benzodioxol-5-yl)-1,2-oxazole-3-carboxylic acid. InChIKey: QJHNOWCMLRIBJY-UHFFFAOYSA-N.
| Molecular formula | C11H7NO5 |
|---|---|
| Molecular weight | 233.18 g/mol |
| IUPAC name | 5-(1,3-benzodioxol-5-yl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | QJHNOWCMLRIBJY-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C3=CC(=NO3)C(=O)O |
Computed by PubChem (NCBI)