Products 111316-33-7
CAS 111316-33-7 is the registry number for α-Glucosidase-IN-5. Offered by: MedChemExpress. Available pack sizes: Get quote.
6,7-dimethoxy-4-methylindeno[1,2-b]pyridin-5-one (CAS 111316-33-7) is a chemical compound with the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. IUPAC name: 6,7-dimethoxy-4-methylindeno[1,2-b]pyridin-5-one. InChIKey: ISWLNLXQUSPKLM-UHFFFAOYSA-N.
| Molecular formula | C15H13NO3 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | 6,7-dimethoxy-4-methylindeno[1,2-b]pyridin-5-one |
| InChIKey | ISWLNLXQUSPKLM-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=NC=C1)C3=C(C2=O)C(=C(C=C3)OC)OC |
Computed by PubChem (NCBI)