CAS 111321-55-2 is the registry number for (R)-a-Amino-N-methyl-benzenepropanamide hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g, 25g.
(2R)-2-amino-N-methyl-3-phenylpropanamide;hydrochloride (CAS 111321-55-2) is a chemical compound with the molecular formula C10H15ClN2O and a molecular weight of 214.69 g/mol. IUPAC name: (2R)-2-amino-N-methyl-3-phenylpropanamide;hydrochloride. InChIKey: UDXSBRWDLXGZIC-SBSPUUFOSA-N.
| Molecular formula | C10H15ClN2O |
|---|---|
| Molecular weight | 214.69 g/mol |
| IUPAC name | (2R)-2-amino-N-methyl-3-phenylpropanamide;hydrochloride |
| InChIKey | UDXSBRWDLXGZIC-SBSPUUFOSA-N |
| SMILES | CNC(=O)[C@@H](CC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)