CAS 17186-56-0 is the registry number for (S)-2-Amino-N-methyl-3-phenylpropanamide hydrochloride, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 250mg, 5g, 500mg, 1g.
[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]azanium chloride (CAS 17186-56-0) is a chemical compound with the molecular formula C10H15ClN2O and a molecular weight of 214.69 g/mol. IUPAC name: [(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]azanium chloride. InChIKey: UDXSBRWDLXGZIC-FVGYRXGTSA-N.
| Molecular formula | C10H15ClN2O |
|---|---|
| Molecular weight | 214.69 g/mol |
| IUPAC name | [(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]azanium chloride |
| InChIKey | UDXSBRWDLXGZIC-FVGYRXGTSA-N |
| SMILES | CNC(=O)[C@H](CC1=CC=CC=C1)[NH3+].[Cl-] |
Computed by PubChem (NCBI)