Products 111385-66-1
CAS 111385-66-1 appears in our catalog under these names: 2-(2,3,4,5,6-Pentamethylbenzoyl)benzoic acid, 95%, 2-(2,3,4,5,6-Pentamethylbenzoyl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g.
2-(2,3,4,5,6-pentamethylbenzoyl)benzoic acid (CAS 111385-66-1) is a chemical compound with the molecular formula C19H20O3 and a molecular weight of 296.4 g/mol. IUPAC name: 2-(2,3,4,5,6-pentamethylbenzoyl)benzoic acid. InChIKey: DQCUMOMIHACOJZ-UHFFFAOYSA-N.
| Molecular formula | C19H20O3 |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | 2-(2,3,4,5,6-pentamethylbenzoyl)benzoic acid |
| InChIKey | DQCUMOMIHACOJZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C)C)C(=O)C2=CC=CC=C2C(=O)O)C)C |
Computed by PubChem (NCBI)