Products 52467-12-6

CAS 52467-12-6 is the registry number for Acerogenin E. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3,17-dihydroxytricyclo[12.3.1.12,6]nonadeca-1(17),2,4,6(19),14(18),15-hexaen-9-one (CAS 52467-12-6) is a chemical compound with the molecular formula C19H20O3 and a molecular weight of 296.4 g/mol. IUPAC name: 3,17-dihydroxytricyclo[12.3.1.12,6]nonadeca-1(17),2,4,6(19),14(18),15-hexaen-9-one. InChIKey: HJJZJFOFYZSPGU-UHFFFAOYSA-N.

Identity
Molecular formulaC19H20O3
Molecular weight296.4 g/mol
IUPAC name3,17-dihydroxytricyclo[12.3.1.12,6]nonadeca-1(17),2,4,6(19),14(18),15-hexaen-9-one
InChIKeyHJJZJFOFYZSPGU-UHFFFAOYSA-N
SMILESC1CCC2=CC(=C(C=C2)O)C3=C(C=CC(=C3)CCC(=O)C1)O

Computed by PubChem (NCBI)

Synonyms: acerogenin E