Products 886587-59-3
CAS 886587-59-3 is the registry number for 4,4'-((4-Hydroxycyclohexylidene)methylene)bis(phenol). Offered by: TRC. Available pack sizes: 100mg.
4-[(4-hydroxycyclohexylidene)-(4-hydroxyphenyl)methyl]phenol (CAS 886587-59-3) is a chemical compound with the molecular formula C19H20O3 and a molecular weight of 296.4 g/mol. IUPAC name: 4-[(4-hydroxycyclohexylidene)-(4-hydroxyphenyl)methyl]phenol. InChIKey: OVPOPDUAZNNTPE-UHFFFAOYSA-N.
| Molecular formula | C19H20O3 |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | 4-[(4-hydroxycyclohexylidene)-(4-hydroxyphenyl)methyl]phenol |
| InChIKey | OVPOPDUAZNNTPE-UHFFFAOYSA-N |
| SMILES | C1CC(=C(C2=CC=C(C=C2)O)C3=CC=C(C=C3)O)CCC1O |
Computed by PubChem (NCBI)