Products 220662-26-0
CAS 220662-26-0 appears in our catalog under these names: Ketoprofen Impurity 35, Ketoprofen Impurity 3, Isopropyl 2-(3-Benzoylphenyl)propionate. Offered by: Chemat Brand, Mikromol. Available pack sizes: on request, 100mg.
Propan-2-yl 2-(3-benzoylphenyl)propanoate (CAS 220662-26-0) is a chemical compound with the molecular formula C19H20O3 and a molecular weight of 296.4 g/mol. IUPAC name: propan-2-yl 2-(3-benzoylphenyl)propanoate. InChIKey: IXHQKBLIJOIESQ-UHFFFAOYSA-N.
| Molecular formula | C19H20O3 |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | propan-2-yl 2-(3-benzoylphenyl)propanoate |
| InChIKey | IXHQKBLIJOIESQ-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C(C)C1=CC(=CC=C1)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)