Products 2273800-75-0
CAS 2273800-75-0 is the registry number for 2,2-Diphenylacetic pivalic anhydride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2,2-diphenylacetyl) 2,2-dimethylpropanoate (CAS 2273800-75-0) is a chemical compound with the molecular formula C19H20O3 and a molecular weight of 296.4 g/mol. IUPAC name: (2,2-diphenylacetyl) 2,2-dimethylpropanoate. InChIKey: LLCCPPYTDZJRIV-UHFFFAOYSA-N.
| Molecular formula | C19H20O3 |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | (2,2-diphenylacetyl) 2,2-dimethylpropanoate |
| InChIKey | LLCCPPYTDZJRIV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OC(=O)C(C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
2,2-Diphenylacetic pivalic anhydride