CAS 1797984-80-5 appears in our catalog under these names: 2-(3-(2,4,5-Trimethylbenzoyl)phenyl)propanoic acid, 98%, Ketoprofen EP Impurity L, Ketoprofen Impurity 12(Ketoprofen EP Impurity L), rac-2’,4’,5’-Trimethyl Ketoprofen, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg.
2-[3-(2,4,5-trimethylbenzoyl)phenyl]propanoic acid (CAS 1797984-80-5) is a chemical compound with the molecular formula C19H20O3 and a molecular weight of 296.4 g/mol. IUPAC name: 2-[3-(2,4,5-trimethylbenzoyl)phenyl]propanoic acid. InChIKey: QISHTWCSIVFJBU-UHFFFAOYSA-N.
| Molecular formula | C19H20O3 |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | 2-[3-(2,4,5-trimethylbenzoyl)phenyl]propanoic acid |
| InChIKey | QISHTWCSIVFJBU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C)C(=O)C2=CC=CC(=C2)C(C)C(=O)O)C |
Computed by PubChem (NCBI)