CAS 1114596-35-8 appears in our catalog under these names: 2-Methyl-4-oxo-4,5,6,7-tetrahydro-1h-indole-3-carboxylic acid, 95%, 2-Methyl-4-oxo-4,5,6,7-tetrahydro-1H-indole-3-carboxylic acid, 95+%, 2-Methyl-4-oxo-4,5,6,7-tetrahydro-1H-indole-3-carboxylic Acid, >95% (HPLC). Offered by: Combi-blocks, Chemat Brand, TRC. Available pack sizes: 250mg, 1g, on request, 100mg, 500mg, 50mg.
2-methyl-4-oxo-1,5,6,7-tetrahydroindole-3-carboxylic acid (CAS 1114596-35-8) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: 2-methyl-4-oxo-1,5,6,7-tetrahydroindole-3-carboxylic acid. InChIKey: YQLHXRVURXSSNP-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 2-methyl-4-oxo-1,5,6,7-tetrahydroindole-3-carboxylic acid |
| InChIKey | YQLHXRVURXSSNP-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1)CCCC2=O)C(=O)O |
Computed by PubChem (NCBI)