Products 1115276-62-4
CAS 1115276-62-4 appears in our catalog under these names: methyl 3-bromo-4-{[(tert-butoxy)carbonyl]amino}benzoate, 95%, Methyl 3-bromo-4-((tert-butoxycarbonyl)amino)benzoate, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 100mg, 250mg.
Methyl 3-bromo-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate (CAS 1115276-62-4) is a chemical compound with the molecular formula C13H16BrNO4 and a molecular weight of 330.17 g/mol. IUPAC name: methyl 3-bromo-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate. InChIKey: UVRJGRWQUNMKBL-UHFFFAOYSA-N.
| Molecular formula | C13H16BrNO4 |
|---|---|
| Molecular weight | 330.17 g/mol |
| IUPAC name | methyl 3-bromo-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate |
| InChIKey | UVRJGRWQUNMKBL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(C=C1)C(=O)OC)Br |
Computed by PubChem (NCBI)