CAS 1159503-14-6 appears in our catalog under these names: (2-Bromophenyl)[(tert-butoxycarbonyl)amino]acetic acid, 95%, 2-(2-Bromophenyl)-2-((tert-butoxycarbonyl)amino)acetic acid, 97%, (2–Bromophenyl)((tert–butoxycarbonyl)amino)acetic acid, Boc-DL-(2-bromophenyl)glycine. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 5g, 100mg, 2,5g.
2-(2-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 1159503-14-6) is a chemical compound with the molecular formula C13H16BrNO4 and a molecular weight of 330.17 g/mol. IUPAC name: 2-(2-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: XAAGWHKTRALRLO-UHFFFAOYSA-N.
| Molecular formula | C13H16BrNO4 |
|---|---|
| Molecular weight | 330.17 g/mol |
| IUPAC name | 2-(2-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | XAAGWHKTRALRLO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C1=CC=CC=C1Br)C(=O)O |
Computed by PubChem (NCBI)