CAS 446305-66-4 appears in our catalog under these names: (3-Bromophenyl)[(tert-butoxycarbonyl)amino]acetic acid, 95%, 2-(3-bromophenyl)-2-((tert-butoxycarbonyl)amino)acetic acid, Boc-DL-Phg(3-Br)-OH 95%, Boc-2-amino-2-(3-bromophenyl)acetic acid, 95%, 95%, 2-(3-Bromophenyl)-2-((tert-butoxycarbonyl)amino)acetic acid, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 0,5g, 5g, 100mg.
2-(3-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 446305-66-4) is a chemical compound with the molecular formula C13H16BrNO4 and a molecular weight of 330.17 g/mol. IUPAC name: 2-(3-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: ZHAAYALRXSZQLX-UHFFFAOYSA-N.
| Molecular formula | C13H16BrNO4 |
|---|---|
| Molecular weight | 330.17 g/mol |
| IUPAC name | 2-(3-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | ZHAAYALRXSZQLX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C1=CC(=CC=C1)Br)C(=O)O |
Computed by PubChem (NCBI)