Products 732291-89-3
CAS 732291-89-3 is the registry number for 2-(2-Bromo-6-ethoxy-4-formylphenoxy)-n,n-dimethylacetamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-(2-bromo-6-ethoxy-4-formylphenoxy)-N,N-dimethylacetamide (CAS 732291-89-3) is a chemical compound with the molecular formula C13H16BrNO4 and a molecular weight of 330.17 g/mol. IUPAC name: 2-(2-bromo-6-ethoxy-4-formylphenoxy)-N,N-dimethylacetamide. InChIKey: LTLPYDYRJGFXKK-UHFFFAOYSA-N.
| Molecular formula | C13H16BrNO4 |
|---|---|
| Molecular weight | 330.17 g/mol |
| IUPAC name | 2-(2-bromo-6-ethoxy-4-formylphenoxy)-N,N-dimethylacetamide |
| InChIKey | LTLPYDYRJGFXKK-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=CC(=C1)C=O)Br)OCC(=O)N(C)C |
Computed by PubChem (NCBI)